C15H18N2O2 — CID 88908781
6-oxo-5-(2-phenylethyl)-3,3a,4,6a-tetrahydro-2H-pyrrolo[2,3-c]pyrrole-1-carbaldehyde (PubChem CID 88908781) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is 6-oxo-5-(2-phenylethyl)-3,3a,4,6a-tetrahydro-2H-pyrrolo[2,3-c]pyrrole-1-carbaldehyde.
| Compound Name | 6-oxo-5-(2-phenylethyl)-3,3a,4,6a-tetrahydro-2H-pyrrolo[2,3-c]pyrrole-1-carbaldehyde |
|---|---|
| PubChem CID | 88908781 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 6-oxo-5-(2-phenylethyl)-3,3a,4,6a-tetrahydro-2H-pyrrolo[2,3-c]pyrrole-1-carbaldehyde |
| SMILES | O=CN1CCC2CN(CCc3ccccc3)C(=O)C21 |
| InChI | InChI=1S/C15H18N2O2/c18-11-17-9-7-13-10-16(15(19)14(13)17)8-6-12-4-2-1-3-5-12/h1-5,11,13-14H,6-10H2 |
| InChIKey | IIEOPYZKHISQQD-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|