C24H36N2O — CID 92631748
(3R)-3-(1-cyclopentylpiperidin-4-yl)-1-(2-phenylethyl)azepan-2-one (PubChem CID 92631748) has the molecular formula C24H36N2O and a molecular weight of 368.57 g/mol. Its IUPAC name is (3R)-3-(1-cyclopentylpiperidin-4-yl)-1-(2-phenylethyl)azepan-2-one.
| Compound Name | (3R)-3-(1-cyclopentylpiperidin-4-yl)-1-(2-phenylethyl)azepan-2-one |
|---|---|
| PubChem CID | 92631748 |
| Molecular Formula | C24H36N2O |
| Molecular Weight | 368.57 g/mol |
| Exact Mass | 368.28 |
| IUPAC Name | (3R)-3-(1-cyclopentylpiperidin-4-yl)-1-(2-phenylethyl)azepan-2-one |
| SMILES | O=C1[C@@H](C2CCN(C3CCCC3)CC2)CCCCN1CCc1ccccc1 |
| InChI | InChI=1S/C24H36N2O/c27-24-23(21-14-18-25(19-15-21)22-10-4-5-11-22)12-6-7-16-26(24)17-13-20-8-2-1-3-9-20/h1-3,8-9,21-23H,4-7,10-19H2/t23-/m1/s1 |
| InChIKey | NDHUHNCELROHBB-HSZRJFAPSA-N |
| XLogP | 4.51 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.57 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |