C26H38N4O — CID 110261906
3-[1-[(1-ethyl-3-methylpyrazol-4-yl)methyl]piperidin-4-yl]-1-(2-phenylethyl)azepan-2-one (PubChem CID 110261906) has the molecular formula C26H38N4O and a molecular weight of 422.62 g/mol. Its IUPAC name is 3-[1-[(1-ethyl-3-methylpyrazol-4-yl)methyl]piperidin-4-yl]-1-(2-phenylethyl)azepan-2-one.
| Compound Name | 3-[1-[(1-ethyl-3-methylpyrazol-4-yl)methyl]piperidin-4-yl]-1-(2-phenylethyl)azepan-2-one |
|---|---|
| PubChem CID | 110261906 |
| Molecular Formula | C26H38N4O |
| Molecular Weight | 422.62 g/mol |
| Exact Mass | 422.30 |
| IUPAC Name | 3-[1-[(1-ethyl-3-methylpyrazol-4-yl)methyl]piperidin-4-yl]-1-(2-phenylethyl)azepan-2-one |
| SMILES | CCn1cc(CN2CCC(C3CCCCN(CCc4ccccc4)C3=O)CC2)c(C)n1 |
| InChI | InChI=1S/C26H38N4O/c1-3-30-20-24(21(2)27-30)19-28-16-13-23(14-17-28)25-11-7-8-15-29(26(25)31)18-12-22-9-5-4-6-10-22/h4-6,9-10,20,23,25H,3,7-8,11-19H2,1-2H3 |
| InChIKey | SQKOBUGAQPCWKB-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.62 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |