C28H37N3O2 — CID 95832143
N-[4-[[4-[(3S)-2-oxo-1-(2-phenylethyl)azepan-3-yl]piperidin-1-yl]methyl]phenyl]acetamide (PubChem CID 95832143) has the molecular formula C28H37N3O2 and a molecular weight of 447.62 g/mol. Its IUPAC name is N-[4-[[4-[(3S)-2-oxo-1-(2-phenylethyl)azepan-3-yl]piperidin-1-yl]methyl]phenyl]acetamide.
| Compound Name | N-[4-[[4-[(3S)-2-oxo-1-(2-phenylethyl)azepan-3-yl]piperidin-1-yl]methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 95832143 |
| Molecular Formula | C28H37N3O2 |
| Molecular Weight | 447.62 g/mol |
| Exact Mass | 447.29 |
| IUPAC Name | N-[4-[[4-[(3S)-2-oxo-1-(2-phenylethyl)azepan-3-yl]piperidin-1-yl]methyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(CN2CCC([C@@H]3CCCCN(CCc4ccccc4)C3=O)CC2)cc1 |
| InChI | InChI=1S/C28H37N3O2/c1-22(32)29-26-12-10-24(11-13-26)21-30-18-15-25(16-19-30)27-9-5-6-17-31(28(27)33)20-14-23-7-3-2-4-8-23/h2-4,7-8,10-13,25,27H,5-6,9,14-21H2,1H3,(H,29,32)/t27-/m0/s1 |
| InChIKey | BGWWDXRHYWIBED-MHZLTWQESA-N |
| XLogP | 4.73 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.62 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |