C24H35N3O2 — CID 92631303
(3R)-1-benzyl-3-[1-(2-oxo-2-pyrrolidin-1-ylethyl)piperidin-4-yl]azepan-2-one (PubChem CID 92631303) has the molecular formula C24H35N3O2 and a molecular weight of 397.56 g/mol. Its IUPAC name is (3R)-1-benzyl-3-[1-(2-oxo-2-pyrrolidin-1-ylethyl)piperidin-4-yl]azepan-2-one.
| Compound Name | (3R)-1-benzyl-3-[1-(2-oxo-2-pyrrolidin-1-ylethyl)piperidin-4-yl]azepan-2-one |
|---|---|
| PubChem CID | 92631303 |
| Molecular Formula | C24H35N3O2 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.27 |
| IUPAC Name | (3R)-1-benzyl-3-[1-(2-oxo-2-pyrrolidin-1-ylethyl)piperidin-4-yl]azepan-2-one |
| SMILES | O=C(CN1CCC([C@H]2CCCCN(Cc3ccccc3)C2=O)CC1)N1CCCC1 |
| InChI | InChI=1S/C24H35N3O2/c28-23(26-13-6-7-14-26)19-25-16-11-21(12-17-25)22-10-4-5-15-27(24(22)29)18-20-8-2-1-3-9-20/h1-3,8-9,21-22H,4-7,10-19H2/t22-/m1/s1 |
| InChIKey | NEKCIPNHPIEXCW-JOCHJYFZSA-N |
| XLogP | 3.15 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |