C25H37N3O2 — CID 110261947
1-benzyl-3-methyl-3-[1-(2-oxo-2-pyrrolidin-1-ylethyl)piperidin-4-yl]azepan-2-one (PubChem CID 110261947) has the molecular formula C25H37N3O2 and a molecular weight of 411.59 g/mol. Its IUPAC name is 1-benzyl-3-methyl-3-[1-(2-oxo-2-pyrrolidin-1-ylethyl)piperidin-4-yl]azepan-2-one.
| Compound Name | 1-benzyl-3-methyl-3-[1-(2-oxo-2-pyrrolidin-1-ylethyl)piperidin-4-yl]azepan-2-one |
|---|---|
| PubChem CID | 110261947 |
| Molecular Formula | C25H37N3O2 |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.29 |
| IUPAC Name | 1-benzyl-3-methyl-3-[1-(2-oxo-2-pyrrolidin-1-ylethyl)piperidin-4-yl]azepan-2-one |
| SMILES | CC1(C2CCN(CC(=O)N3CCCC3)CC2)CCCCN(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C25H37N3O2/c1-25(13-5-6-16-28(24(25)30)19-21-9-3-2-4-10-21)22-11-17-26(18-12-22)20-23(29)27-14-7-8-15-27/h2-4,9-10,22H,5-8,11-20H2,1H3 |
| InChIKey | RGJWMWASQPRMSP-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |