C26H33N3O2 — CID 95832138
(3S)-1-benzyl-3-methyl-3-[1-(2-pyridin-2-ylacetyl)piperidin-4-yl]azepan-2-one (PubChem CID 95832138) has the molecular formula C26H33N3O2 and a molecular weight of 419.57 g/mol. Its IUPAC name is (3S)-1-benzyl-3-methyl-3-[1-(2-pyridin-2-ylacetyl)piperidin-4-yl]azepan-2-one.
| Compound Name | (3S)-1-benzyl-3-methyl-3-[1-(2-pyridin-2-ylacetyl)piperidin-4-yl]azepan-2-one |
|---|---|
| PubChem CID | 95832138 |
| Molecular Formula | C26H33N3O2 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.26 |
| IUPAC Name | (3S)-1-benzyl-3-methyl-3-[1-(2-pyridin-2-ylacetyl)piperidin-4-yl]azepan-2-one |
| SMILES | C[C@@]1(C2CCN(C(=O)Cc3ccccn3)CC2)CCCCN(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C26H33N3O2/c1-26(14-6-8-16-29(25(26)31)20-21-9-3-2-4-10-21)22-12-17-28(18-13-22)24(30)19-23-11-5-7-15-27-23/h2-5,7,9-11,15,22H,6,8,12-14,16-20H2,1H3/t26-/m0/s1 |
| InChIKey | AFRPUWZVQPWFKN-SANMLTNESA-N |
| XLogP | 4.08 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |