C24H30N4O2 — CID 95832139
(3R)-1-benzyl-3-methyl-3-[1-(pyrazine-2-carbonyl)piperidin-4-yl]azepan-2-one (PubChem CID 95832139) has the molecular formula C24H30N4O2 and a molecular weight of 406.53 g/mol. Its IUPAC name is (3R)-1-benzyl-3-methyl-3-[1-(pyrazine-2-carbonyl)piperidin-4-yl]azepan-2-one.
| Compound Name | (3R)-1-benzyl-3-methyl-3-[1-(pyrazine-2-carbonyl)piperidin-4-yl]azepan-2-one |
|---|---|
| PubChem CID | 95832139 |
| Molecular Formula | C24H30N4O2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | (3R)-1-benzyl-3-methyl-3-[1-(pyrazine-2-carbonyl)piperidin-4-yl]azepan-2-one |
| SMILES | C[C@]1(C2CCN(C(=O)c3cnccn3)CC2)CCCCN(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C24H30N4O2/c1-24(11-5-6-14-28(23(24)30)18-19-7-3-2-4-8-19)20-9-15-27(16-10-20)22(29)21-17-25-12-13-26-21/h2-4,7-8,12-13,17,20H,5-6,9-11,14-16,18H2,1H3/t24-/m1/s1 |
| InChIKey | AUPOYZFJPFFSIR-XMMPIXPASA-N |
| XLogP | 3.55 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |