C26H31FN2O2 — CID 92631686
(3R)-1-benzyl-3-[1-[2-(4-fluorophenyl)acetyl]piperidin-4-yl]azepan-2-one (PubChem CID 92631686) has the molecular formula C26H31FN2O2 and a molecular weight of 422.54 g/mol. Its IUPAC name is (3R)-1-benzyl-3-[1-[2-(4-fluorophenyl)acetyl]piperidin-4-yl]azepan-2-one.
| Compound Name | (3R)-1-benzyl-3-[1-[2-(4-fluorophenyl)acetyl]piperidin-4-yl]azepan-2-one |
|---|---|
| PubChem CID | 92631686 |
| Molecular Formula | C26H31FN2O2 |
| Molecular Weight | 422.54 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | (3R)-1-benzyl-3-[1-[2-(4-fluorophenyl)acetyl]piperidin-4-yl]azepan-2-one |
| SMILES | O=C(Cc1ccc(F)cc1)N1CCC([C@H]2CCCCN(Cc3ccccc3)C2=O)CC1 |
| InChI | InChI=1S/C26H31FN2O2/c27-23-11-9-20(10-12-23)18-25(30)28-16-13-22(14-17-28)24-8-4-5-15-29(26(24)31)19-21-6-2-1-3-7-21/h1-3,6-7,9-12,22,24H,4-5,8,13-19H2/t24-/m1/s1 |
| InChIKey | OPXYBGUBBOGGIN-XMMPIXPASA-N |
| XLogP | 4.44 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.54 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |