C27H31FN2O2 — CID 110260616
1-benzyl-6-[1-[3-(4-fluorophenyl)propanoyl]piperidin-4-yl]-5,6-dihydro-2H-azepin-7-one (PubChem CID 110260616) has the molecular formula C27H31FN2O2 and a molecular weight of 434.56 g/mol. Its IUPAC name is 1-benzyl-6-[1-[3-(4-fluorophenyl)propanoyl]piperidin-4-yl]-5,6-dihydro-2H-azepin-7-one.
| Compound Name | 1-benzyl-6-[1-[3-(4-fluorophenyl)propanoyl]piperidin-4-yl]-5,6-dihydro-2H-azepin-7-one |
|---|---|
| PubChem CID | 110260616 |
| Molecular Formula | C27H31FN2O2 |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | 1-benzyl-6-[1-[3-(4-fluorophenyl)propanoyl]piperidin-4-yl]-5,6-dihydro-2H-azepin-7-one |
| SMILES | O=C(CCc1ccc(F)cc1)N1CCC(C2CC=CCN(Cc3ccccc3)C2=O)CC1 |
| InChI | InChI=1S/C27H31FN2O2/c28-24-12-9-21(10-13-24)11-14-26(31)29-18-15-23(16-19-29)25-8-4-5-17-30(27(25)32)20-22-6-2-1-3-7-22/h1-7,9-10,12-13,23,25H,8,11,14-20H2 |
| InChIKey | RZVVVNQWGMJIHP-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|