C22H25NOSe — CID 101476539
1-(2-phenylethyl)-3-(1-phenylselanylethenyl)azepan-2-one (PubChem CID 101476539) has the molecular formula C22H25NOSe and a molecular weight of 398.41 g/mol. Its IUPAC name is 1-(2-phenylethyl)-3-(1-phenylselanylethenyl)azepan-2-one.
| Compound Name | 1-(2-phenylethyl)-3-(1-phenylselanylethenyl)azepan-2-one |
|---|---|
| PubChem CID | 101476539 |
| Molecular Formula | C22H25NOSe |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | 1-(2-phenylethyl)-3-(1-phenylselanylethenyl)azepan-2-one |
| SMILES | C=C([Se]c1ccccc1)C1CCCCN(CCc2ccccc2)C1=O |
| InChI | InChI=1S/C22H25NOSe/c1-18(25-20-12-6-3-7-13-20)21-14-8-9-16-23(22(21)24)17-15-19-10-4-2-5-11-19/h2-7,10-13,21H,1,8-9,14-17H2 |
| InChIKey | FZXBWVCYKYQAQK-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|