C27H40N4O3 — CID 11634152
(2S)-N-[(1S)-2-[(3aS,6aS)-6-oxo-5-(2-phenylethyl)-3,3a,4,6a-tetrahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-1-cyclohexyl-2-oxoethyl]-2-(methylamino)butanamide (PubChem CID 11634152) has the molecular formula C27H40N4O3 and a molecular weight of 468.64 g/mol. Its IUPAC name is (2S)-N-[(1S)-2-[(3aS,6aS)-6-oxo-5-(2-phenylethyl)-3,3a,4,6a-tetrahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-1-cyclohexyl-2-oxoethyl]-2-(methylamino)butanamide.
| Compound Name | (2S)-N-[(1S)-2-[(3aS,6aS)-6-oxo-5-(2-phenylethyl)-3,3a,4,6a-tetrahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-1-cyclohexyl-2-oxoethyl]-2-(methylamino)butanamide |
|---|---|
| PubChem CID | 11634152 |
| Molecular Formula | C27H40N4O3 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.31 |
| IUPAC Name | (2S)-N-[(1S)-2-[(3aS,6aS)-6-oxo-5-(2-phenylethyl)-3,3a,4,6a-tetrahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-1-cyclohexyl-2-oxoethyl]-2-(methylamino)butanamide |
| SMILES | CC[C@H](NC)C(=O)N[C@H](C(=O)N1CC[C@H]2CN(CCc3ccccc3)C(=O)[C@H]21)C1CCCCC1 |
| InChI | InChI=1S/C27H40N4O3/c1-3-22(28-2)25(32)29-23(20-12-8-5-9-13-20)26(33)31-17-15-21-18-30(27(34)24(21)31)16-14-19-10-6-4-7-11-19/h4,6-7,10-11,20-24,28H,3,5,8-9,12-18H2,1-2H3,(H,29,32)/t21-,22-,23-,24-/m0/s1 |
| InChIKey | MHZUGLDLNUYCGM-ZJZGAYNASA-N |
| XLogP | 2.35 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |