C29H44N4O3 — CID 143118348
(2S)-N-[2-[(3aR,8aS)-8-oxo-7-(2-phenylethyl)-3,3a,4,5,6,8a-hexahydro-2H-pyrrolo[2,3-c]azepin-1-yl]-1-cyclohexyl-2-oxoethyl]-2-(methylamino)butanamide (PubChem CID 143118348) has the molecular formula C29H44N4O3 and a molecular weight of 496.70 g/mol. Its IUPAC name is (2S)-N-[2-[(3aR,8aS)-8-oxo-7-(2-phenylethyl)-3,3a,4,5,6,8a-hexahydro-2H-pyrrolo[2,3-c]azepin-1-yl]-1-cyclohexyl-2-oxoethyl]-2-(methylamino)butanamide.
| Compound Name | (2S)-N-[2-[(3aR,8aS)-8-oxo-7-(2-phenylethyl)-3,3a,4,5,6,8a-hexahydro-2H-pyrrolo[2,3-c]azepin-1-yl]-1-cyclohexyl-2-oxoethyl]-2-(methylamino)butanamide |
|---|---|
| PubChem CID | 143118348 |
| Molecular Formula | C29H44N4O3 |
| Molecular Weight | 496.70 g/mol |
| Exact Mass | 496.34 |
| IUPAC Name | (2S)-N-[2-[(3aR,8aS)-8-oxo-7-(2-phenylethyl)-3,3a,4,5,6,8a-hexahydro-2H-pyrrolo[2,3-c]azepin-1-yl]-1-cyclohexyl-2-oxoethyl]-2-(methylamino)butanamide |
| SMILES | CC[C@H](NC)C(=O)NC(C(=O)N1CC[C@H]2CCCN(CCc3ccccc3)C(=O)[C@H]21)C1CCCCC1 |
| InChI | InChI=1S/C29H44N4O3/c1-3-24(30-2)27(34)31-25(22-13-8-5-9-14-22)28(35)33-20-17-23-15-10-18-32(29(36)26(23)33)19-16-21-11-6-4-7-12-21/h4,6-7,11-12,22-26,30H,3,5,8-10,13-20H2,1-2H3,(H,31,34)/t23-,24+,25?,26+/m1/s1 |
| InChIKey | ALOBRUAKDNRWKM-NNQWSVJYSA-N |
| XLogP | 3.13 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.70 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |