C24H31NO4 — CID 67115056
3-[2-[4-methoxy-3-(1-methyl-4-phenylpiperidin-4-yl)phenyl]ethoxy]propanoic acid (PubChem CID 67115056) has the molecular formula C24H31NO4 and a molecular weight of 397.52 g/mol. Its IUPAC name is 3-[2-[4-methoxy-3-(1-methyl-4-phenylpiperidin-4-yl)phenyl]ethoxy]propanoic acid.
| Compound Name | 3-[2-[4-methoxy-3-(1-methyl-4-phenylpiperidin-4-yl)phenyl]ethoxy]propanoic acid |
|---|---|
| PubChem CID | 67115056 |
| Molecular Formula | C24H31NO4 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | 3-[2-[4-methoxy-3-(1-methyl-4-phenylpiperidin-4-yl)phenyl]ethoxy]propanoic acid |
| SMILES | COc1ccc(CCOCCC(=O)O)cc1C1(c2ccccc2)CCN(C)CC1 |
| InChI | InChI=1S/C24H31NO4/c1-25-14-12-24(13-15-25,20-6-4-3-5-7-20)21-18-19(8-9-22(21)28-2)10-16-29-17-11-23(26)27/h3-9,18H,10-17H2,1-2H3,(H,26,27) |
| InChIKey | INUYUTRZICPJMM-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|