C24H31NO4 — CID 123643723
3-[2-[2-(1-ethyl-4-phenylpiperidin-4-yl)-3-hydroxyphenyl]ethoxy]propanoic acid (PubChem CID 123643723) has the molecular formula C24H31NO4 and a molecular weight of 397.52 g/mol. Its IUPAC name is 3-[2-[2-(1-ethyl-4-phenylpiperidin-4-yl)-3-hydroxyphenyl]ethoxy]propanoic acid.
| Compound Name | 3-[2-[2-(1-ethyl-4-phenylpiperidin-4-yl)-3-hydroxyphenyl]ethoxy]propanoic acid |
|---|---|
| PubChem CID | 123643723 |
| Molecular Formula | C24H31NO4 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | 3-[2-[2-(1-ethyl-4-phenylpiperidin-4-yl)-3-hydroxyphenyl]ethoxy]propanoic acid |
| SMILES | CCN1CCC(c2ccccc2)(c2c(O)cccc2CCOCCC(=O)O)CC1 |
| InChI | InChI=1S/C24H31NO4/c1-2-25-15-13-24(14-16-25,20-8-4-3-5-9-20)23-19(7-6-10-21(23)26)11-17-29-18-12-22(27)28/h3-10,26H,2,11-18H2,1H3,(H,27,28) |
| InChIKey | WCDUGVDNBRRXFV-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|