C22H24BN3O4 — CID 67115148
[2-[5-(aminomethyl)spiro[2H-1-benzofuran-3,4'-piperidine]-1'-carbonyl]-7H-indol-4-yl]boronic acid (PubChem CID 67115148) has the molecular formula C22H24BN3O4 and a molecular weight of 405.26 g/mol. Its IUPAC name is [2-[5-(aminomethyl)spiro[2H-1-benzofuran-3,4'-piperidine]-1'-carbonyl]-7H-indol-4-yl]boronic acid.
| Compound Name | [2-[5-(aminomethyl)spiro[2H-1-benzofuran-3,4'-piperidine]-1'-carbonyl]-7H-indol-4-yl]boronic acid |
|---|---|
| PubChem CID | 67115148 |
| Molecular Formula | C22H24BN3O4 |
| Molecular Weight | 405.26 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | [2-[5-(aminomethyl)spiro[2H-1-benzofuran-3,4'-piperidine]-1'-carbonyl]-7H-indol-4-yl]boronic acid |
| SMILES | NCc1ccc2c(c1)C1(CCN(C(=O)C3=CC4=C(B(O)O)C=CCC4=N3)CC1)CO2 |
| InChI | InChI=1S/C22H24BN3O4/c24-12-14-4-5-20-16(10-14)22(13-30-20)6-8-26(9-7-22)21(27)19-11-15-17(23(28)29)2-1-3-18(15)25-19/h1-2,4-5,10-11,28-29H,3,6-9,12-13,24H2 |
| InChIKey | WJKAPGQGVNMTEX-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 108.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.26 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|