C26H32N2O2 — CID 67279501
1-[5-(aminomethyl)spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl]-2-(4-tert-butylphenyl)prop-2-en-1-one (PubChem CID 67279501) has the molecular formula C26H32N2O2 and a molecular weight of 404.55 g/mol. Its IUPAC name is 1-[5-(aminomethyl)spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl]-2-(4-tert-butylphenyl)prop-2-en-1-one.
| Compound Name | 1-[5-(aminomethyl)spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl]-2-(4-tert-butylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 67279501 |
| Molecular Formula | C26H32N2O2 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.25 |
| IUPAC Name | 1-[5-(aminomethyl)spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl]-2-(4-tert-butylphenyl)prop-2-en-1-one |
| SMILES | C=C(C(=O)N1CCC2(CC1)COc1ccc(CN)cc12)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C26H32N2O2/c1-18(20-6-8-21(9-7-20)25(2,3)4)24(29)28-13-11-26(12-14-28)17-30-23-10-5-19(16-27)15-22(23)26/h5-10,15H,1,11-14,16-17,27H2,2-4H3 |
| InChIKey | XSFRXJXONIOESS-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|