C33H27F2N3O3 — CID 67118287
methyl 2-amino-5-[4-[4-[(E)-2-[4-(2,4-difluorophenyl)-1-ethylimidazol-2-yl]ethenyl]phenyl]phenoxy]benzoate (PubChem CID 67118287) has the molecular formula C33H27F2N3O3 and a molecular weight of 551.59 g/mol. Its IUPAC name is methyl 2-amino-5-[4-[4-[(E)-2-[4-(2,4-difluorophenyl)-1-ethylimidazol-2-yl]ethenyl]phenyl]phenoxy]benzoate.
| Compound Name | methyl 2-amino-5-[4-[4-[(E)-2-[4-(2,4-difluorophenyl)-1-ethylimidazol-2-yl]ethenyl]phenyl]phenoxy]benzoate |
|---|---|
| PubChem CID | 67118287 |
| Molecular Formula | C33H27F2N3O3 |
| Molecular Weight | 551.59 g/mol |
| Exact Mass | 551.20 |
| IUPAC Name | methyl 2-amino-5-[4-[4-[(E)-2-[4-(2,4-difluorophenyl)-1-ethylimidazol-2-yl]ethenyl]phenyl]phenoxy]benzoate |
| SMILES | CCn1cc(-c2ccc(F)cc2F)nc1/C=C/c1ccc(-c2ccc(Oc3ccc(N)c(C(=O)OC)c3)cc2)cc1 |
| InChI | InChI=1S/C33H27F2N3O3/c1-3-38-20-31(27-15-11-24(34)18-29(27)35)37-32(38)17-6-21-4-7-22(8-5-21)23-9-12-25(13-10-23)41-26-14-16-30(36)28(19-26)33(39)40-2/h4-20H,3,36H2,1-2H3/b17-6+ |
| InChIKey | ZZEACIKZMOLXPZ-UBKPWBPPSA-N |
| XLogP | 7.85 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.59 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|