C19H16N8 — CID 67122004
14-(5-phenylpyrazol-1-yl)-2,4,5,11,13,15-hexazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),3,5,12,14-pentaene (PubChem CID 67122004) has the molecular formula C19H16N8 and a molecular weight of 356.39 g/mol. Its IUPAC name is 14-(5-phenylpyrazol-1-yl)-2,4,5,11,13,15-hexazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),3,5,12,14-pentaene.
| Compound Name | 14-(5-phenylpyrazol-1-yl)-2,4,5,11,13,15-hexazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),3,5,12,14-pentaene |
|---|---|
| PubChem CID | 67122004 |
| Molecular Formula | C19H16N8 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 14-(5-phenylpyrazol-1-yl)-2,4,5,11,13,15-hexazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),3,5,12,14-pentaene |
| SMILES | c1ccc(-c2ccnn2-c2ncc3c(n2)N2CCCC2c2nncn2-3)cc1 |
| InChI | InChI=1S/C19H16N8/c1-2-5-13(6-3-1)14-8-9-22-27(14)19-20-11-16-17(23-19)25-10-4-7-15(25)18-24-21-12-26(16)18/h1-3,5-6,8-9,11-12,15H,4,7,10H2 |
| InChIKey | OLWUYHFIAJTPCJ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 77.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |