C18H29NO4 — CID 67124964
ethane-1,2-diol;2-(2-hydroxyethylamino)butan-1-ol;naphthalene (PubChem CID 67124964) has the molecular formula C18H29NO4 and a molecular weight of 323.43 g/mol. Its IUPAC name is ethane-1,2-diol;2-(2-hydroxyethylamino)butan-1-ol;naphthalene.
| Compound Name | ethane-1,2-diol;2-(2-hydroxyethylamino)butan-1-ol;naphthalene |
|---|---|
| PubChem CID | 67124964 |
| Molecular Formula | C18H29NO4 |
| Molecular Weight | 323.43 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | ethane-1,2-diol;2-(2-hydroxyethylamino)butan-1-ol;naphthalene |
| SMILES | CCC(CO)NCCO.OCCO.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.C6H15NO2.C2H6O2/c1-2-6-10-8-4-3-7-9(10)5-1;1-2-6(5-9)7-3-4-8;3-1-2-4/h1-8H;6-9H,2-5H2,1H3;3-4H,1-2H2 |
| InChIKey | QQGGQCORWMBZCA-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.43 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |