C20H16FN5O2 — CID 67126937
N-[6-amino-5-[5-(furan-2-ylmethyl)-1H-pyrazol-3-yl]-2-pyridinyl]-2-fluorobenzamide (PubChem CID 67126937) has the molecular formula C20H16FN5O2 and a molecular weight of 377.38 g/mol. Its IUPAC name is N-[6-amino-5-[5-(furan-2-ylmethyl)-1H-pyrazol-3-yl]-2-pyridinyl]-2-fluorobenzamide.
| Compound Name | N-[6-amino-5-[5-(furan-2-ylmethyl)-1H-pyrazol-3-yl]-2-pyridinyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 67126937 |
| Molecular Formula | C20H16FN5O2 |
| Molecular Weight | 377.38 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | N-[6-amino-5-[5-(furan-2-ylmethyl)-1H-pyrazol-3-yl]-2-pyridinyl]-2-fluorobenzamide |
| SMILES | Nc1nc(NC(=O)c2ccccc2F)ccc1-c1cc(Cc2ccco2)[nH]n1 |
| InChI | InChI=1S/C20H16FN5O2/c21-16-6-2-1-5-14(16)20(27)24-18-8-7-15(19(22)23-18)17-11-12(25-26-17)10-13-4-3-9-28-13/h1-9,11H,10H2,(H,25,26)(H3,22,23,24,27) |
| InChIKey | YACHUDXYCRTLRU-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 109.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |