C12H20N4O2 — CID 67127585
butyl 3-(4-aminopyrazol-1-yl)pyrrolidine-1-carboxylate (PubChem CID 67127585) has the molecular formula C12H20N4O2 and a molecular weight of 252.32 g/mol. Its IUPAC name is butyl 3-(4-aminopyrazol-1-yl)pyrrolidine-1-carboxylate.
| Compound Name | butyl 3-(4-aminopyrazol-1-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 67127585 |
| Molecular Formula | C12H20N4O2 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | butyl 3-(4-aminopyrazol-1-yl)pyrrolidine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCC(n2cc(N)cn2)C1 |
| InChI | InChI=1S/C12H20N4O2/c1-2-3-6-18-12(17)15-5-4-11(9-15)16-8-10(13)7-14-16/h7-8,11H,2-6,9,13H2,1H3 |
| InChIKey | GSCPQDKVHPVTGL-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|