C14H16F3NO3S — CID 67130429
4-[2-[3-(trifluoromethyl)phenyl]sulfonylpropan-2-yl]pyrrolidin-2-one (PubChem CID 67130429) has the molecular formula C14H16F3NO3S and a molecular weight of 335.35 g/mol. Its IUPAC name is 4-[2-[3-(trifluoromethyl)phenyl]sulfonylpropan-2-yl]pyrrolidin-2-one.
| Compound Name | 4-[2-[3-(trifluoromethyl)phenyl]sulfonylpropan-2-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 67130429 |
| Molecular Formula | C14H16F3NO3S |
| Molecular Weight | 335.35 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | 4-[2-[3-(trifluoromethyl)phenyl]sulfonylpropan-2-yl]pyrrolidin-2-one |
| SMILES | CC(C)(C1CNC(=O)C1)S(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H16F3NO3S/c1-13(2,10-7-12(19)18-8-10)22(20,21)11-5-3-4-9(6-11)14(15,16)17/h3-6,10H,7-8H2,1-2H3,(H,18,19) |
| InChIKey | WIJMAYZWDPVZGK-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.35 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |