C13H9F3I2N2 — CID 67133053
1-cyclopropyl-4,5-diiodo-2-[3-(trifluoromethyl)phenyl]imidazole (PubChem CID 67133053) has the molecular formula C13H9F3I2N2 and a molecular weight of 504.03 g/mol. Its IUPAC name is 1-cyclopropyl-4,5-diiodo-2-[3-(trifluoromethyl)phenyl]imidazole.
| Compound Name | 1-cyclopropyl-4,5-diiodo-2-[3-(trifluoromethyl)phenyl]imidazole |
|---|---|
| PubChem CID | 67133053 |
| Molecular Formula | C13H9F3I2N2 |
| Molecular Weight | 504.03 g/mol |
| Exact Mass | 503.88 |
| IUPAC Name | 1-cyclopropyl-4,5-diiodo-2-[3-(trifluoromethyl)phenyl]imidazole |
| SMILES | FC(F)(F)c1cccc(-c2nc(I)c(I)n2C2CC2)c1 |
| InChI | InChI=1S/C13H9F3I2N2/c14-13(15,16)8-3-1-2-7(6-8)12-19-10(17)11(18)20(12)9-4-5-9/h1-3,6,9H,4-5H2 |
| InChIKey | SQOJIYGVBVXSEI-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.03 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|