C13H10F3IN2O2 — CID 67133111
3-ethyl-5-iodo-2-[3-(trifluoromethyl)phenyl]imidazole-4-carboxylic acid (PubChem CID 67133111) has the molecular formula C13H10F3IN2O2 and a molecular weight of 410.13 g/mol. Its IUPAC name is 3-ethyl-5-iodo-2-[3-(trifluoromethyl)phenyl]imidazole-4-carboxylic acid.
| Compound Name | 3-ethyl-5-iodo-2-[3-(trifluoromethyl)phenyl]imidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 67133111 |
| Molecular Formula | C13H10F3IN2O2 |
| Molecular Weight | 410.13 g/mol |
| Exact Mass | 409.97 |
| IUPAC Name | 3-ethyl-5-iodo-2-[3-(trifluoromethyl)phenyl]imidazole-4-carboxylic acid |
| SMILES | CCn1c(-c2cccc(C(F)(F)F)c2)nc(I)c1C(=O)O |
| InChI | InChI=1S/C13H10F3IN2O2/c1-2-19-9(12(20)21)10(17)18-11(19)7-4-3-5-8(6-7)13(14,15)16/h3-6H,2H2,1H3,(H,20,21) |
| InChIKey | UHFMFXDVLMDAJN-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.13 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|