C21H19F3N6O — CID 67134999
1-propyl-8-[6-[[3-(trifluoromethyl)phenyl]methylamino]-3-pyridinyl]-7H-purin-6-one (PubChem CID 67134999) has the molecular formula C21H19F3N6O and a molecular weight of 428.42 g/mol. Its IUPAC name is 1-propyl-8-[6-[[3-(trifluoromethyl)phenyl]methylamino]-3-pyridinyl]-7H-purin-6-one.
| Compound Name | 1-propyl-8-[6-[[3-(trifluoromethyl)phenyl]methylamino]-3-pyridinyl]-7H-purin-6-one |
|---|---|
| PubChem CID | 67134999 |
| Molecular Formula | C21H19F3N6O |
| Molecular Weight | 428.42 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 1-propyl-8-[6-[[3-(trifluoromethyl)phenyl]methylamino]-3-pyridinyl]-7H-purin-6-one |
| SMILES | CCCn1cnc2nc(-c3ccc(NCc4cccc(C(F)(F)F)c4)nc3)[nH]c2c1=O |
| InChI | InChI=1S/C21H19F3N6O/c1-2-8-30-12-27-19-17(20(30)31)28-18(29-19)14-6-7-16(26-11-14)25-10-13-4-3-5-15(9-13)21(22,23)24/h3-7,9,11-12H,2,8,10H2,1H3,(H,25,26)(H,28,29) |
| InChIKey | ARQFJAYKXLLFNE-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.42 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |