C26H25Cl2N2O3+ — CID 67135719
2-(2,4-dichlorophenoxy)propanoic acid;1,2-dimethyl-3,5-diphenylpyrazol-2-ium (PubChem CID 67135719) has the molecular formula C26H25Cl2N2O3+ and a molecular weight of 484.40 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)propanoic acid;1,2-dimethyl-3,5-diphenylpyrazol-2-ium.
| Compound Name | 2-(2,4-dichlorophenoxy)propanoic acid;1,2-dimethyl-3,5-diphenylpyrazol-2-ium |
|---|---|
| PubChem CID | 67135719 |
| Molecular Formula | C26H25Cl2N2O3+ |
| Molecular Weight | 484.40 g/mol |
| Exact Mass | 483.12 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)propanoic acid;1,2-dimethyl-3,5-diphenylpyrazol-2-ium |
| SMILES | CC(Oc1ccc(Cl)cc1Cl)C(=O)O.Cn1c(-c2ccccc2)cc(-c2ccccc2)[n+]1C |
| InChI | InChI=1S/C17H17N2.C9H8Cl2O3/c1-18-16(14-9-5-3-6-10-14)13-17(19(18)2)15-11-7-4-8-12-15;1-5(9(12)13)14-8-3-2-6(10)4-7(8)11/h3-13H,1-2H3;2-5H,1H3,(H,12,13)/q+1; |
| InChIKey | QKYYTPJWEGKSHO-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 55.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.40 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|