C29H34N8O3 — CID 67137598
2-[2-(dimethylamino)ethoxy]ethyl N-[4-[(1-benzylindazol-5-yl)amino]-5-ethylpyrrolo[2,1-f][1,2,4]triazin-6-yl]carbamate (PubChem CID 67137598) has the molecular formula C29H34N8O3 and a molecular weight of 542.64 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethoxy]ethyl N-[4-[(1-benzylindazol-5-yl)amino]-5-ethylpyrrolo[2,1-f][1,2,4]triazin-6-yl]carbamate.
| Compound Name | 2-[2-(dimethylamino)ethoxy]ethyl N-[4-[(1-benzylindazol-5-yl)amino]-5-ethylpyrrolo[2,1-f][1,2,4]triazin-6-yl]carbamate |
|---|---|
| PubChem CID | 67137598 |
| Molecular Formula | C29H34N8O3 |
| Molecular Weight | 542.64 g/mol |
| Exact Mass | 542.28 |
| IUPAC Name | 2-[2-(dimethylamino)ethoxy]ethyl N-[4-[(1-benzylindazol-5-yl)amino]-5-ethylpyrrolo[2,1-f][1,2,4]triazin-6-yl]carbamate |
| SMILES | CCc1c(NC(=O)OCCOCCN(C)C)cn2ncnc(Nc3ccc4c(cnn4Cc4ccccc4)c3)c12 |
| InChI | InChI=1S/C29H34N8O3/c1-4-24-25(34-29(38)40-15-14-39-13-12-35(2)3)19-37-27(24)28(30-20-32-37)33-23-10-11-26-22(16-23)17-31-36(26)18-21-8-6-5-7-9-21/h5-11,16-17,19-20H,4,12-15,18H2,1-3H3,(H,34,38)(H,30,32,33) |
| InChIKey | UIKMSVVBRKAPRS-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 110.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.64 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|