C36H47N5O6 — CID 67139225
ethyl 4-[2-tert-butyl-6-(4-cyanopiperidin-1-yl)-4-[2-[6-ethoxy-3-imino-5-(methylcarbamoyl)-1H-isoindol-2-yl]acetyl]phenoxy]butanoate (PubChem CID 67139225) has the molecular formula C36H47N5O6 and a molecular weight of 645.80 g/mol. Its IUPAC name is ethyl 4-[2-tert-butyl-6-(4-cyanopiperidin-1-yl)-4-[2-[6-ethoxy-3-imino-5-(methylcarbamoyl)-1H-isoindol-2-yl]acetyl]phenoxy]butanoate.
| Compound Name | ethyl 4-[2-tert-butyl-6-(4-cyanopiperidin-1-yl)-4-[2-[6-ethoxy-3-imino-5-(methylcarbamoyl)-1H-isoindol-2-yl]acetyl]phenoxy]butanoate |
|---|---|
| PubChem CID | 67139225 |
| Molecular Formula | C36H47N5O6 |
| Molecular Weight | 645.80 g/mol |
| Exact Mass | 645.35 |
| IUPAC Name | ethyl 4-[2-tert-butyl-6-(4-cyanopiperidin-1-yl)-4-[2-[6-ethoxy-3-imino-5-(methylcarbamoyl)-1H-isoindol-2-yl]acetyl]phenoxy]butanoate |
| SMILES | [H]/N=C1/c2cc(C(=O)NC)c(OCC)cc2CN1CC(=O)c1cc(N2CCC(C#N)CC2)c(OCCCC(=O)OCC)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C36H47N5O6/c1-7-45-31-18-25-21-41(34(38)26(25)19-27(31)35(44)39-6)22-30(42)24-16-28(36(3,4)5)33(47-15-9-10-32(43)46-8-2)29(17-24)40-13-11-23(20-37)12-14-40/h16-19,23,38H,7-15,21-22H2,1-6H3,(H,39,44)/b38-34- |
| InChIKey | MAOIVQYUTQXPGH-RXJYLVDRSA-N |
| XLogP | 5.23 |
| TPSA | 145.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.80 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|