C19H20N4O2 — CID 67140783
7-methyl-2-[5-(2-propan-2-yloxyethylamino)-2-pyridinyl]-1,3-benzoxazole-5-carbonitrile (PubChem CID 67140783) has the molecular formula C19H20N4O2 and a molecular weight of 336.40 g/mol. Its IUPAC name is 7-methyl-2-[5-(2-propan-2-yloxyethylamino)-2-pyridinyl]-1,3-benzoxazole-5-carbonitrile.
| Compound Name | 7-methyl-2-[5-(2-propan-2-yloxyethylamino)-2-pyridinyl]-1,3-benzoxazole-5-carbonitrile |
|---|---|
| PubChem CID | 67140783 |
| Molecular Formula | C19H20N4O2 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 7-methyl-2-[5-(2-propan-2-yloxyethylamino)-2-pyridinyl]-1,3-benzoxazole-5-carbonitrile |
| SMILES | Cc1cc(C#N)cc2nc(-c3ccc(NCCOC(C)C)cn3)oc12 |
| InChI | InChI=1S/C19H20N4O2/c1-12(2)24-7-6-21-15-4-5-16(22-11-15)19-23-17-9-14(10-20)8-13(3)18(17)25-19/h4-5,8-9,11-12,21H,6-7H2,1-3H3 |
| InChIKey | AZOAPEJECCQVGU-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 83.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|