C21H23ClFN3 — CID 67141212
2-(5-fluoro-2,3-dimethyl-1-prop-2-enylpyrrolo[2,3-c]pyridin-7-yl)-3,4-dihydro-1H-isoquinoline;hydrochloride (PubChem CID 67141212) has the molecular formula C21H23ClFN3 and a molecular weight of 371.89 g/mol. Its IUPAC name is 2-(5-fluoro-2,3-dimethyl-1-prop-2-enylpyrrolo[2,3-c]pyridin-7-yl)-3,4-dihydro-1H-isoquinoline;hydrochloride.
| Compound Name | 2-(5-fluoro-2,3-dimethyl-1-prop-2-enylpyrrolo[2,3-c]pyridin-7-yl)-3,4-dihydro-1H-isoquinoline;hydrochloride |
|---|---|
| PubChem CID | 67141212 |
| Molecular Formula | C21H23ClFN3 |
| Molecular Weight | 371.89 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 2-(5-fluoro-2,3-dimethyl-1-prop-2-enylpyrrolo[2,3-c]pyridin-7-yl)-3,4-dihydro-1H-isoquinoline;hydrochloride |
| SMILES | C=CCn1c(C)c(C)c2cc(F)nc(N3CCc4ccccc4C3)c21.Cl |
| InChI | InChI=1S/C21H22FN3.ClH/c1-4-10-25-15(3)14(2)18-12-19(22)23-21(20(18)25)24-11-9-16-7-5-6-8-17(16)13-24;/h4-8,12H,1,9-11,13H2,2-3H3;1H |
| InChIKey | MCGUZKUXUMBOCF-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.89 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|