C19H20ClN3 — CID 87285407
2-(5-chloro-1,2,3-trimethylpyrrolo[2,3-c]pyridin-7-yl)-3,4-dihydro-1H-isoquinoline (PubChem CID 87285407) has the molecular formula C19H20ClN3 and a molecular weight of 325.84 g/mol. Its IUPAC name is 2-(5-chloro-1,2,3-trimethylpyrrolo[2,3-c]pyridin-7-yl)-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-(5-chloro-1,2,3-trimethylpyrrolo[2,3-c]pyridin-7-yl)-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 87285407 |
| Molecular Formula | C19H20ClN3 |
| Molecular Weight | 325.84 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 2-(5-chloro-1,2,3-trimethylpyrrolo[2,3-c]pyridin-7-yl)-3,4-dihydro-1H-isoquinoline |
| SMILES | Cc1c(C)n(C)c2c(N3CCc4ccccc4C3)nc(Cl)cc12 |
| InChI | InChI=1S/C19H20ClN3/c1-12-13(2)22(3)18-16(12)10-17(20)21-19(18)23-9-8-14-6-4-5-7-15(14)11-23/h4-7,10H,8-9,11H2,1-3H3 |
| InChIKey | HEDDCQYHKUTHMW-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.84 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|