C34H35N3O7S — CID 67141282
N-[[4-(5,9-dicyclopropyloxy-6-oxo-5,7,8,9-tetrahydropyrrolo[3,4-h]quinolin-7-yl)-3-methylphenyl]methylsulfonyl]-2-(2-methoxyphenyl)acetamide (PubChem CID 67141282) has the molecular formula C34H35N3O7S and a molecular weight of 629.74 g/mol. Its IUPAC name is N-[[4-(5,9-dicyclopropyloxy-6-oxo-5,7,8,9-tetrahydropyrrolo[3,4-h]quinolin-7-yl)-3-methylphenyl]methylsulfonyl]-2-(2-methoxyphenyl)acetamide.
| Compound Name | N-[[4-(5,9-dicyclopropyloxy-6-oxo-5,7,8,9-tetrahydropyrrolo[3,4-h]quinolin-7-yl)-3-methylphenyl]methylsulfonyl]-2-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 67141282 |
| Molecular Formula | C34H35N3O7S |
| Molecular Weight | 629.74 g/mol |
| Exact Mass | 629.22 |
| IUPAC Name | N-[[4-(5,9-dicyclopropyloxy-6-oxo-5,7,8,9-tetrahydropyrrolo[3,4-h]quinolin-7-yl)-3-methylphenyl]methylsulfonyl]-2-(2-methoxyphenyl)acetamide |
| SMILES | COc1ccccc1CC(=O)NS(=O)(=O)Cc1ccc(C2NC(OC3CC3)C3=C2C(=O)C(OC2CC2)c2cccnc23)c(C)c1 |
| InChI | InChI=1S/C34H35N3O7S/c1-19-16-20(18-45(40,41)37-27(38)17-21-6-3-4-8-26(21)42-2)9-14-24(19)31-28-29(34(36-31)44-23-12-13-23)30-25(7-5-15-35-30)33(32(28)39)43-22-10-11-22/h3-9,14-16,22-23,31,33-34,36H,10-13,17-18H2,1-2H3,(H,37,38) |
| InChIKey | MPFRAYXNRSVSSO-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 132.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.74 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |