C23H24O — CID 67142679
8-propan-2-ylspiro[3,4-dihydroanthracene-2,5'-bicyclo[2.2.1]hept-2-ene]-1-one (PubChem CID 67142679) has the molecular formula C23H24O and a molecular weight of 316.44 g/mol. Its IUPAC name is 8-propan-2-ylspiro[3,4-dihydroanthracene-2,5'-bicyclo[2.2.1]hept-2-ene]-1-one.
| Compound Name | 8-propan-2-ylspiro[3,4-dihydroanthracene-2,5'-bicyclo[2.2.1]hept-2-ene]-1-one |
|---|---|
| PubChem CID | 67142679 |
| Molecular Formula | C23H24O |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 8-propan-2-ylspiro[3,4-dihydroanthracene-2,5'-bicyclo[2.2.1]hept-2-ene]-1-one |
| SMILES | CC(C)c1cccc2cc3c(cc12)C(=O)C1(CC3)CC2C=CC1C2 |
| InChI | InChI=1S/C23H24O/c1-14(2)19-5-3-4-16-11-17-8-9-23(13-15-6-7-18(23)10-15)22(24)21(17)12-20(16)19/h3-7,11-12,14-15,18H,8-10,13H2,1-2H3 |
| InChIKey | IFZISZYKZCVQJN-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|