C16H17NO — CID 67993983
7-aminospiro[3,4-dihydronaphthalene-2,5'-bicyclo[2.2.1]hept-2-ene]-1-one (PubChem CID 67993983) has the molecular formula C16H17NO and a molecular weight of 239.32 g/mol. Its IUPAC name is 7-aminospiro[3,4-dihydronaphthalene-2,5'-bicyclo[2.2.1]hept-2-ene]-1-one.
| Compound Name | 7-aminospiro[3,4-dihydronaphthalene-2,5'-bicyclo[2.2.1]hept-2-ene]-1-one |
|---|---|
| PubChem CID | 67993983 |
| Molecular Formula | C16H17NO |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 7-aminospiro[3,4-dihydronaphthalene-2,5'-bicyclo[2.2.1]hept-2-ene]-1-one |
| SMILES | Nc1ccc2c(c1)C(=O)C1(CC2)CC2C=CC1C2 |
| InChI | InChI=1S/C16H17NO/c17-13-4-2-11-5-6-16(15(18)14(11)8-13)9-10-1-3-12(16)7-10/h1-4,8,10,12H,5-7,9,17H2 |
| InChIKey | NYUNJBHNBDEYGL-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|