C10H13NO — CID 100933181
(1R,4R,5S)-spiro[bicyclo[2.2.1]hept-2-ene-5,3'-pyrrolidine]-2'-one (PubChem CID 100933181) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is (1R,4R,5S)-spiro[bicyclo[2.2.1]hept-2-ene-5,3'-pyrrolidine]-2'-one.
| Compound Name | (1R,4R,5S)-spiro[bicyclo[2.2.1]hept-2-ene-5,3'-pyrrolidine]-2'-one |
|---|---|
| PubChem CID | 100933181 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | (1R,4R,5S)-spiro[bicyclo[2.2.1]hept-2-ene-5,3'-pyrrolidine]-2'-one |
| SMILES | O=C1NCC[C@]12C[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C10H13NO/c12-9-10(3-4-11-9)6-7-1-2-8(10)5-7/h1-2,7-8H,3-6H2,(H,11,12)/t7-,8+,10-/m1/s1 |
| InChIKey | IEVXRJSJDZQBJF-KHQFGBGNSA-N |
| XLogP | 1.09 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|