C32H32F4N6O4 — CID 67142732
3-[(2R)-2-amino-2-phenylethyl]-1-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl]-6-methyl-5-[4-[(3-nitrophenyl)methyl]piperazin-1-yl]pyrimidine-2,4-dione (PubChem CID 67142732) has the molecular formula C32H32F4N6O4 and a molecular weight of 640.64 g/mol. Its IUPAC name is 3-[(2R)-2-amino-2-phenylethyl]-1-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl]-6-methyl-5-[4-[(3-nitrophenyl)methyl]piperazin-1-yl]pyrimidine-2,4-dione.
| Compound Name | 3-[(2R)-2-amino-2-phenylethyl]-1-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl]-6-methyl-5-[4-[(3-nitrophenyl)methyl]piperazin-1-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 67142732 |
| Molecular Formula | C32H32F4N6O4 |
| Molecular Weight | 640.64 g/mol |
| Exact Mass | 640.24 |
| IUPAC Name | 3-[(2R)-2-amino-2-phenylethyl]-1-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl]-6-methyl-5-[4-[(3-nitrophenyl)methyl]piperazin-1-yl]pyrimidine-2,4-dione |
| SMILES | Cc1c(N2CCN(Cc3cccc([N+](=O)[O-])c3)CC2)c(=O)n(C[C@H](N)c2ccccc2)c(=O)n1Cc1c(F)cccc1C(F)(F)F |
| InChI | InChI=1S/C32H32F4N6O4/c1-21-29(39-15-13-38(14-16-39)18-22-7-5-10-24(17-22)42(45)46)30(43)41(20-28(37)23-8-3-2-4-9-23)31(44)40(21)19-25-26(32(34,35)36)11-6-12-27(25)33/h2-12,17,28H,13-16,18-20,37H2,1H3/t28-/m0/s1 |
| InChIKey | NAGZEMJCNODDCR-NDEPHWFRSA-N |
| XLogP | 4.46 |
| TPSA | 119.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.64 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|