C32H32F4N6O5 — CID 67143024
3-[(2S)-2-amino-2-(2-hydroxyphenyl)ethyl]-1-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl]-6-methyl-5-[4-[(3-nitrophenyl)methyl]piperazin-1-yl]pyrimidine-2,4-dione (PubChem CID 67143024) has the molecular formula C32H32F4N6O5 and a molecular weight of 656.64 g/mol. Its IUPAC name is 3-[(2S)-2-amino-2-(2-hydroxyphenyl)ethyl]-1-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl]-6-methyl-5-[4-[(3-nitrophenyl)methyl]piperazin-1-yl]pyrimidine-2,4-dione.
| Compound Name | 3-[(2S)-2-amino-2-(2-hydroxyphenyl)ethyl]-1-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl]-6-methyl-5-[4-[(3-nitrophenyl)methyl]piperazin-1-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 67143024 |
| Molecular Formula | C32H32F4N6O5 |
| Molecular Weight | 656.64 g/mol |
| Exact Mass | 656.24 |
| IUPAC Name | 3-[(2S)-2-amino-2-(2-hydroxyphenyl)ethyl]-1-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl]-6-methyl-5-[4-[(3-nitrophenyl)methyl]piperazin-1-yl]pyrimidine-2,4-dione |
| SMILES | Cc1c(N2CCN(Cc3cccc([N+](=O)[O-])c3)CC2)c(=O)n(C[C@@H](N)c2ccccc2O)c(=O)n1Cc1c(F)cccc1C(F)(F)F |
| InChI | InChI=1S/C32H32F4N6O5/c1-20-29(39-14-12-38(13-15-39)17-21-6-4-7-22(16-21)42(46)47)30(44)41(19-27(37)23-8-2-3-11-28(23)43)31(45)40(20)18-24-25(32(34,35)36)9-5-10-26(24)33/h2-11,16,27,43H,12-15,17-19,37H2,1H3/t27-/m1/s1 |
| InChIKey | HJBXCJFPMUUPQQ-HHHXNRCGSA-N |
| XLogP | 4.16 |
| TPSA | 139.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.64 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|