C20H24O — CID 67143952
5-(2-methylpropyl)spiro[3,4-dihydronaphthalene-1,5'-bicyclo[2.2.1]hept-1-ene]-2-one (PubChem CID 67143952) has the molecular formula C20H24O and a molecular weight of 280.41 g/mol. Its IUPAC name is 5-(2-methylpropyl)spiro[3,4-dihydronaphthalene-1,5'-bicyclo[2.2.1]hept-1-ene]-2-one.
| Compound Name | 5-(2-methylpropyl)spiro[3,4-dihydronaphthalene-1,5'-bicyclo[2.2.1]hept-1-ene]-2-one |
|---|---|
| PubChem CID | 67143952 |
| Molecular Formula | C20H24O |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 5-(2-methylpropyl)spiro[3,4-dihydronaphthalene-1,5'-bicyclo[2.2.1]hept-1-ene]-2-one |
| SMILES | CC(C)Cc1cccc2c1CCC(=O)C21CC2=CCC1C2 |
| InChI | InChI=1S/C20H24O/c1-13(2)10-15-4-3-5-18-17(15)8-9-19(21)20(18)12-14-6-7-16(20)11-14/h3-6,13,16H,7-12H2,1-2H3 |
| InChIKey | IPIFGOPMROOOTO-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|