C10H15N5O2 — CID 67144529
1-ethoxy-6-ethyl-3-methoxypyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 67144529) has the molecular formula C10H15N5O2 and a molecular weight of 237.26 g/mol. Its IUPAC name is 1-ethoxy-6-ethyl-3-methoxypyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 1-ethoxy-6-ethyl-3-methoxypyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 67144529 |
| Molecular Formula | C10H15N5O2 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 1-ethoxy-6-ethyl-3-methoxypyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | CCOn1nc(OC)c2c(N)nc(CC)nc21 |
| InChI | InChI=1S/C10H15N5O2/c1-4-6-12-8(11)7-9(13-6)15(17-5-2)14-10(7)16-3/h4-5H2,1-3H3,(H2,11,12,13) |
| InChIKey | OZIUWVMTTPARRQ-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |