C14H25F3N2O3 — CID 67145347
tert-butyl N-[1-hydroxy-1-[4-(trifluoromethyl)piperidin-1-yl]propan-2-yl]carbamate (PubChem CID 67145347) has the molecular formula C14H25F3N2O3 and a molecular weight of 326.36 g/mol. Its IUPAC name is tert-butyl N-[1-hydroxy-1-[4-(trifluoromethyl)piperidin-1-yl]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-hydroxy-1-[4-(trifluoromethyl)piperidin-1-yl]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 67145347 |
| Molecular Formula | C14H25F3N2O3 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | tert-butyl N-[1-hydroxy-1-[4-(trifluoromethyl)piperidin-1-yl]propan-2-yl]carbamate |
| SMILES | CC(NC(=O)OC(C)(C)C)C(O)N1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H25F3N2O3/c1-9(18-12(21)22-13(2,3)4)11(20)19-7-5-10(6-8-19)14(15,16)17/h9-11,20H,5-8H2,1-4H3,(H,18,21) |
| InChIKey | GOWZSSCPSUZSTJ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |