C29H35NO5S2 — CID 67146015
2-[4-[methyl-[3-[4-(2-oxopropyl)phenoxy]propyl]amino]cyclohexyl]oxy-2,2-dithiophen-2-ylacetic acid (PubChem CID 67146015) has the molecular formula C29H35NO5S2 and a molecular weight of 541.74 g/mol. Its IUPAC name is 2-[4-[methyl-[3-[4-(2-oxopropyl)phenoxy]propyl]amino]cyclohexyl]oxy-2,2-dithiophen-2-ylacetic acid.
| Compound Name | 2-[4-[methyl-[3-[4-(2-oxopropyl)phenoxy]propyl]amino]cyclohexyl]oxy-2,2-dithiophen-2-ylacetic acid |
|---|---|
| PubChem CID | 67146015 |
| Molecular Formula | C29H35NO5S2 |
| Molecular Weight | 541.74 g/mol |
| Exact Mass | 541.20 |
| IUPAC Name | 2-[4-[methyl-[3-[4-(2-oxopropyl)phenoxy]propyl]amino]cyclohexyl]oxy-2,2-dithiophen-2-ylacetic acid |
| SMILES | CC(=O)Cc1ccc(OCCCN(C)C2CCC(OC(C(=O)O)(c3cccs3)c3cccs3)CC2)cc1 |
| InChI | InChI=1S/C29H35NO5S2/c1-21(31)20-22-8-12-24(13-9-22)34-17-5-16-30(2)23-10-14-25(15-11-23)35-29(28(32)33,26-6-3-18-36-26)27-7-4-19-37-27/h3-4,6-9,12-13,18-19,23,25H,5,10-11,14-17,20H2,1-2H3,(H,32,33) |
| InChIKey | KXZGZMGNXVBRBV-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.74 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|