C25H26N4O2S — CID 67147510
N-[[2-(5,6-dimethoxy-1-methylindol-3-yl)-1H-pyrrolo[2,3-b]pyridin-4-yl]methyl]-2-thiophen-2-ylethanamine (PubChem CID 67147510) has the molecular formula C25H26N4O2S and a molecular weight of 446.58 g/mol. Its IUPAC name is N-[[2-(5,6-dimethoxy-1-methylindol-3-yl)-1H-pyrrolo[2,3-b]pyridin-4-yl]methyl]-2-thiophen-2-ylethanamine.
| Compound Name | N-[[2-(5,6-dimethoxy-1-methylindol-3-yl)-1H-pyrrolo[2,3-b]pyridin-4-yl]methyl]-2-thiophen-2-ylethanamine |
|---|---|
| PubChem CID | 67147510 |
| Molecular Formula | C25H26N4O2S |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | N-[[2-(5,6-dimethoxy-1-methylindol-3-yl)-1H-pyrrolo[2,3-b]pyridin-4-yl]methyl]-2-thiophen-2-ylethanamine |
| SMILES | COc1cc2c(-c3cc4c(CNCCc5cccs5)ccnc4[nH]3)cn(C)c2cc1OC |
| InChI | InChI=1S/C25H26N4O2S/c1-29-15-20(19-12-23(30-2)24(31-3)13-22(19)29)21-11-18-16(6-9-27-25(18)28-21)14-26-8-7-17-5-4-10-32-17/h4-6,9-13,15,26H,7-8,14H2,1-3H3,(H,27,28) |
| InChIKey | IBAFOBZSLUTNQK-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 64.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|