About 5-bromo-2-[(3S)-3-(2,6-dichloro-4-methylphenoxy)pyrrolidin-1-yl]pyridine
5-bromo-2-[(3S)-3-(2,6-dichloro-4-methylphenoxy)pyrrolidin-1-yl]pyridine (PubChem CID 67148219) has the molecular formula C16H15BrCl2N2O
and a molecular weight of 402.12 g/mol. Its IUPAC name is 5-bromo-2-[(3S)-3-(2,6-dichloro-4-methylphenoxy)pyrrolidin-1-yl]pyridine.
Molecular Properties
| Compound Name | 5-bromo-2-[(3S)-3-(2,6-dichloro-4-methylphenoxy)pyrrolidin-1-yl]pyridine |
| PubChem CID | 67148219 |
| Molecular Formula | C16H15BrCl2N2O |
| Molecular Weight | 402.12 g/mol |
| Exact Mass | 399.97 |
| IUPAC Name | 5-bromo-2-[(3S)-3-(2,6-dichloro-4-methylphenoxy)pyrrolidin-1-yl]pyridine |
| SMILES | Cc1cc(Cl)c(O[C@H]2CCN(c3ccc(Br)cn3)C2)c(Cl)c1 |
| InChI | InChI=1S/C16H15BrCl2N2O/c1-10-6-13(18)16(14(19)7-10)22-12-4-5-21(9-12)15-3-2-11(17)8-20-15/h2-3,6-8,12H,4-5,9H2,1H3/t12-/m0/s1 |
| InChIKey | BVJRRWBEFMPKJS-LBPRGKRZSA-N |
| XLogP | 5.12 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.12 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-bromo-2-[(3S)-3-(2,6-dichloro-4-methylphenoxy)pyrrolidin-1-yl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-[(3S)-3-(2,6-dichloro-4-methylphenoxy)pyrrolidin-1-yl]pyridine?
The IUPAC name of 5-bromo-2-[(3S)-3-(2,6-dichloro-4-methylphenoxy)pyrrolidin-1-yl]pyridine (CID 67148219) is 5-bromo-2-[(3S)-3-(2,6-dichloro-4-methylphenoxy)pyrrolidin-1-yl]pyridine.
What is the SMILES notation for 5-bromo-2-[(3S)-3-(2,6-dichloro-4-methylphenoxy)pyrrolidin-1-yl]pyridine?
The canonical SMILES for 5-bromo-2-[(3S)-3-(2,6-dichloro-4-methylphenoxy)pyrrolidin-1-yl]pyridine is Cc1cc(Cl)c(O[C@H]2CCN(c3ccc(Br)cn3)C2)c(Cl)c1.
What is the InChIKey of 5-bromo-2-[(3S)-3-(2,6-dichloro-4-methylphenoxy)pyrrolidin-1-yl]pyridine?
The InChIKey is BVJRRWBEFMPKJS-LBPRGKRZSA-N. The full InChI is InChI=1S/C16H15BrCl2N2O/c1-10-6-13(18)16(14(19)7-10)22-12-4-5-21(9-12)15-3-2-11(17)8-20-15/h2-3,6-8,12H,4-5,9H2,1H3/t12-/m0/s1.
What are the key properties of 5-bromo-2-[(3S)-3-(2,6-dichloro-4-methylphenoxy)pyrrolidin-1-yl]pyridine?
5-bromo-2-[(3S)-3-(2,6-dichloro-4-methylphenoxy)pyrrolidin-1-yl]pyridine has a molecular weight of 402.12 g/mol, XLogP of 5.12, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-[(3S)-3-(2,6-dichloro-4-methylphenoxy)pyrrolidin-1-yl]pyridine is sourced from PubChem (CID 67148219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).