C25H32FN3O4 — CID 67148314
benzyl 2-[3-fluoro-4-[(3R)-3-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pyrrolidin-1-yl]anilino]acetate (PubChem CID 67148314) has the molecular formula C25H32FN3O4 and a molecular weight of 457.55 g/mol. Its IUPAC name is benzyl 2-[3-fluoro-4-[(3R)-3-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pyrrolidin-1-yl]anilino]acetate.
| Compound Name | benzyl 2-[3-fluoro-4-[(3R)-3-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pyrrolidin-1-yl]anilino]acetate |
|---|---|
| PubChem CID | 67148314 |
| Molecular Formula | C25H32FN3O4 |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | benzyl 2-[3-fluoro-4-[(3R)-3-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pyrrolidin-1-yl]anilino]acetate |
| SMILES | CN(C(=O)OC(C)(C)C)[C@@H]1CCN(c2ccc(NCC(=O)OCc3ccccc3)cc2F)C1 |
| InChI | InChI=1S/C25H32FN3O4/c1-25(2,3)33-24(31)28(4)20-12-13-29(16-20)22-11-10-19(14-21(22)26)27-15-23(30)32-17-18-8-6-5-7-9-18/h5-11,14,20,27H,12-13,15-17H2,1-4H3/t20-/m1/s1 |
| InChIKey | FOAKDXBOFHQFOT-HXUWFJFHSA-N |
| XLogP | 4.43 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|