C21H16F2O3 — CID 67150363
methyl 3-[[4-(2,4-difluorophenyl)phenoxy]methyl]benzoate (PubChem CID 67150363) has the molecular formula C21H16F2O3 and a molecular weight of 354.35 g/mol. Its IUPAC name is methyl 3-[[4-(2,4-difluorophenyl)phenoxy]methyl]benzoate.
| Compound Name | methyl 3-[[4-(2,4-difluorophenyl)phenoxy]methyl]benzoate |
|---|---|
| PubChem CID | 67150363 |
| Molecular Formula | C21H16F2O3 |
| Molecular Weight | 354.35 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | methyl 3-[[4-(2,4-difluorophenyl)phenoxy]methyl]benzoate |
| SMILES | COC(=O)c1cccc(COc2ccc(-c3ccc(F)cc3F)cc2)c1 |
| InChI | InChI=1S/C21H16F2O3/c1-25-21(24)16-4-2-3-14(11-16)13-26-18-8-5-15(6-9-18)19-10-7-17(22)12-20(19)23/h2-12H,13H2,1H3 |
| InChIKey | VNAYYMYOVHYPNH-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.35 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |