C18H19F2NO2 — CID 124570688
methyl 3-[[[(1R)-1-(2,4-difluorophenyl)propyl]amino]methyl]benzoate (PubChem CID 124570688) has the molecular formula C18H19F2NO2 and a molecular weight of 319.35 g/mol. Its IUPAC name is methyl 3-[[[(1R)-1-(2,4-difluorophenyl)propyl]amino]methyl]benzoate.
| Compound Name | methyl 3-[[[(1R)-1-(2,4-difluorophenyl)propyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 124570688 |
| Molecular Formula | C18H19F2NO2 |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | methyl 3-[[[(1R)-1-(2,4-difluorophenyl)propyl]amino]methyl]benzoate |
| SMILES | CC[C@@H](NCc1cccc(C(=O)OC)c1)c1ccc(F)cc1F |
| InChI | InChI=1S/C18H19F2NO2/c1-3-17(15-8-7-14(19)10-16(15)20)21-11-12-5-4-6-13(9-12)18(22)23-2/h4-10,17,21H,3,11H2,1-2H3/t17-/m1/s1 |
| InChIKey | DXALGMCBXFYRRV-QGZVFWFLSA-N |
| XLogP | 3.99 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |