C24H34N2S2 — CID 67150399
2,5-bis(3-propylhept-1-ynyl)-[1,3]thiazolo[5,4-d][1,3]thiazole (PubChem CID 67150399) has the molecular formula C24H34N2S2 and a molecular weight of 414.68 g/mol. Its IUPAC name is 2,5-bis(3-propylhept-1-ynyl)-[1,3]thiazolo[5,4-d][1,3]thiazole.
| Compound Name | 2,5-bis(3-propylhept-1-ynyl)-[1,3]thiazolo[5,4-d][1,3]thiazole |
|---|---|
| PubChem CID | 67150399 |
| Molecular Formula | C24H34N2S2 |
| Molecular Weight | 414.68 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | 2,5-bis(3-propylhept-1-ynyl)-[1,3]thiazolo[5,4-d][1,3]thiazole |
| SMILES | CCCCC(C#Cc1nc2sc(C#CC(CCC)CCCC)nc2s1)CCC |
| InChI | InChI=1S/C24H34N2S2/c1-5-9-13-19(11-7-3)15-17-21-25-23-24(27-21)26-22(28-23)18-16-20(12-8-4)14-10-6-2/h19-20H,5-14H2,1-4H3 |
| InChIKey | FYJHVVUACBRZHM-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.68 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|