C9H17N3O4 — CID 67154203
(2S)-2-amino-3-(oxan-4-ylcarbamoylamino)propanoic acid (PubChem CID 67154203) has the molecular formula C9H17N3O4 and a molecular weight of 231.25 g/mol. Its IUPAC name is (2S)-2-amino-3-(oxan-4-ylcarbamoylamino)propanoic acid.
| Compound Name | (2S)-2-amino-3-(oxan-4-ylcarbamoylamino)propanoic acid |
|---|---|
| PubChem CID | 67154203 |
| Molecular Formula | C9H17N3O4 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | (2S)-2-amino-3-(oxan-4-ylcarbamoylamino)propanoic acid |
| SMILES | N[C@@H](CNC(=O)NC1CCOCC1)C(=O)O |
| InChI | InChI=1S/C9H17N3O4/c10-7(8(13)14)5-11-9(15)12-6-1-3-16-4-2-6/h6-7H,1-5,10H2,(H,13,14)(H2,11,12,15)/t7-/m0/s1 |
| InChIKey | UQOKVAIGGLSACU-ZETCQYMHSA-N |
| XLogP | -1.12 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |