C24H32F3N3O2 — CID 67157023
[2-methyl-5-[[2-[3-(trifluoromethyl)anilino]phenyl]methylamino]octan-2-yl] carbamate (PubChem CID 67157023) has the molecular formula C24H32F3N3O2 and a molecular weight of 451.53 g/mol. Its IUPAC name is [2-methyl-5-[[2-[3-(trifluoromethyl)anilino]phenyl]methylamino]octan-2-yl] carbamate.
| Compound Name | [2-methyl-5-[[2-[3-(trifluoromethyl)anilino]phenyl]methylamino]octan-2-yl] carbamate |
|---|---|
| PubChem CID | 67157023 |
| Molecular Formula | C24H32F3N3O2 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | [2-methyl-5-[[2-[3-(trifluoromethyl)anilino]phenyl]methylamino]octan-2-yl] carbamate |
| SMILES | CCCC(CCC(C)(C)OC(N)=O)NCc1ccccc1Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H32F3N3O2/c1-4-8-19(13-14-23(2,3)32-22(28)31)29-16-17-9-5-6-12-21(17)30-20-11-7-10-18(15-20)24(25,26)27/h5-7,9-12,15,19,29-30H,4,8,13-14,16H2,1-3H3,(H2,28,31) |
| InChIKey | CWAWNSVJCXQHMP-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |